Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Potassium acetate, 99%
CAS: 127-08-2 Molecular Formula: C2H3KO2 Molecular Weight (g/mol): 98.142 MDL Number: MFCD00012458 InChI Key: SCVFZCLFOSHCOH-UHFFFAOYSA-M Synonym: potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 PubChem CID: 517044 ChEBI: CHEBI:32029 IUPAC Name: potassium;acetate SMILES: CC(=O)[O-].[K+]
| PubChem CID | 517044 |
|---|---|
| CAS | 127-08-2 |
| Molecular Weight (g/mol) | 98.142 |
| ChEBI | CHEBI:32029 |
| MDL Number | MFCD00012458 |
| SMILES | CC(=O)[O-].[K+] |
| Synonym | potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 |
| IUPAC Name | potassium;acetate |
| InChI Key | SCVFZCLFOSHCOH-UHFFFAOYSA-M |
| Molecular Formula | C2H3KO2 |
3-Methylstyrene, 95%
CAS: 100-80-1 Molecular Formula: C9H10 Molecular Weight (g/mol): 118.18 InChI Key: JZHGRUMIRATHIU-UHFFFAOYSA-N Synonym: 3-methylstyrene,3-vinyltoluene,1-methyl-3-vinylbenzene,m-vinyltoluene,m-methylstyrene,benzene, 1-ethenyl-3-methyl,styrene, m-methyl,m-methyl styrene,meta-methylstyrene,unii-ffk4i9430g PubChem CID: 7529 IUPAC Name: 1-ethenyl-3-methylbenzene SMILES: CC1=CC=CC(=C1)C=C
| PubChem CID | 7529 |
|---|---|
| CAS | 100-80-1 |
| Molecular Weight (g/mol) | 118.18 |
| SMILES | CC1=CC=CC(=C1)C=C |
| Synonym | 3-methylstyrene,3-vinyltoluene,1-methyl-3-vinylbenzene,m-vinyltoluene,m-methylstyrene,benzene, 1-ethenyl-3-methyl,styrene, m-methyl,m-methyl styrene,meta-methylstyrene,unii-ffk4i9430g |
| IUPAC Name | 1-ethenyl-3-methylbenzene |
| InChI Key | JZHGRUMIRATHIU-UHFFFAOYSA-N |
| Molecular Formula | C9H10 |
Tri-(2-furyl)phosphine, 98%
CAS: 5518-52-5 Molecular Formula: C12H9O3P Molecular Weight (g/mol): 232.18 MDL Number: MFCD00151857 InChI Key: DLQYXUGCCKQSRJ-UHFFFAOYSA-N Synonym: tri 2-furyl phosphine,tri furan-2-yl phosphine,tri-2-furyl phosphine,tris furan-2-yl phosphane,tri-2-furylphosphine,tris 2-furyl phosphine,tri furan-2-yl phosphane,trifurylphosphine,tri fur-2-yl phosphane,tris 2-furanyl phosphine PubChem CID: 521585 IUPAC Name: tris(furan-2-yl)phosphane SMILES: O1C=CC=C1P(C1=CC=CO1)C1=CC=CO1
| PubChem CID | 521585 |
|---|---|
| CAS | 5518-52-5 |
| Molecular Weight (g/mol) | 232.18 |
| MDL Number | MFCD00151857 |
| SMILES | O1C=CC=C1P(C1=CC=CO1)C1=CC=CO1 |
| Synonym | tri 2-furyl phosphine,tri furan-2-yl phosphine,tri-2-furyl phosphine,tris furan-2-yl phosphane,tri-2-furylphosphine,tris 2-furyl phosphine,tri furan-2-yl phosphane,trifurylphosphine,tri fur-2-yl phosphane,tris 2-furanyl phosphine |
| IUPAC Name | tris(furan-2-yl)phosphane |
| InChI Key | DLQYXUGCCKQSRJ-UHFFFAOYSA-N |
| Molecular Formula | C12H9O3P |
Diisopropylamine, 99+%, Thermo Scientific Chemicals
CAS: 108-18-9 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.193 MDL Number: MFCD00008862 InChI Key: UAOMVDZJSHZZME-UHFFFAOYSA-N Synonym: diisopropylamine,2-propanamine, n-1-methylethyl,n-1-methylethyl-2-propanamine,dipa,n,n-diisopropylamine,bis propan-2-yl amine,n-isopropylpropan-2-amine,di-isopropylamine,n-isopropyl-1-amino-2-methylethane,diisopropyl amine PubChem CID: 7912 IUPAC Name: N-propan-2-ylpropan-2-amine SMILES: CC(C)NC(C)C
| PubChem CID | 7912 |
|---|---|
| CAS | 108-18-9 |
| Molecular Weight (g/mol) | 101.193 |
| MDL Number | MFCD00008862 |
| SMILES | CC(C)NC(C)C |
| Synonym | diisopropylamine,2-propanamine, n-1-methylethyl,n-1-methylethyl-2-propanamine,dipa,n,n-diisopropylamine,bis propan-2-yl amine,n-isopropylpropan-2-amine,di-isopropylamine,n-isopropyl-1-amino-2-methylethane,diisopropyl amine |
| IUPAC Name | N-propan-2-ylpropan-2-amine |
| InChI Key | UAOMVDZJSHZZME-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
4-Methylpiperidine, 98+%
CAS: 626-58-4 Molecular Formula: C6H13N Molecular Weight (g/mol): 99.18 MDL Number: MFCD00006005 InChI Key: UZOFELREXGAFOI-UHFFFAOYSA-N Synonym: 4-pipecoline,piperidine, 4-methyl,gamma-pipecoline,4-methylpiperidin,.gamma.-pipecoline,4-methyl-piperidine,4-methylpiperdine,4-methylpyperidine,4-methyl piperidine,hexahydro-g-picoline PubChem CID: 69381 IUPAC Name: 4-methylpiperidine SMILES: CC1CCNCC1
| PubChem CID | 69381 |
|---|---|
| CAS | 626-58-4 |
| Molecular Weight (g/mol) | 99.18 |
| MDL Number | MFCD00006005 |
| SMILES | CC1CCNCC1 |
| Synonym | 4-pipecoline,piperidine, 4-methyl,gamma-pipecoline,4-methylpiperidin,.gamma.-pipecoline,4-methyl-piperidine,4-methylpiperdine,4-methylpyperidine,4-methyl piperidine,hexahydro-g-picoline |
| IUPAC Name | 4-methylpiperidine |
| InChI Key | UZOFELREXGAFOI-UHFFFAOYSA-N |
| Molecular Formula | C6H13N |
Thermo Scientific Chemicals Barium diphenylaminesulfonate, pure, indicator grade
CAS: 6211-24-1 Molecular Formula: C24H20BaN2O6S2 Molecular Weight (g/mol): 633.88 MDL Number: MFCD00007497 InChI Key: IVCNVXFNTKXMCA-UHFFFAOYSA-L Synonym: barium diphenylamine-4-sulfonate,barium diphenylaminesulfonate,benzenesulfonic acid, 4-phenylamino-, barium salt 2:1,barium bis 4-anilinobenzenesulphonate,barium diphenylamine sulfonate,n-phenylsufanilic acid barium,unii-ssj5f79159,diphenylamine-4-sulfonic acid barium salt,n-phenylsufanilic acid, barium salt,4-anilinobenzenesulfonate; barium 2+ PubChem CID: 80342 IUPAC Name: 4-anilinobenzenesulfonate;barium(2+) SMILES: [Ba++].[O-]S(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1.[O-]S(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1
| PubChem CID | 80342 |
|---|---|
| CAS | 6211-24-1 |
| Molecular Weight (g/mol) | 633.88 |
| MDL Number | MFCD00007497 |
| SMILES | [Ba++].[O-]S(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1.[O-]S(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1 |
| Synonym | barium diphenylamine-4-sulfonate,barium diphenylaminesulfonate,benzenesulfonic acid, 4-phenylamino-, barium salt 2:1,barium bis 4-anilinobenzenesulphonate,barium diphenylamine sulfonate,n-phenylsufanilic acid barium,unii-ssj5f79159,diphenylamine-4-sulfonic acid barium salt,n-phenylsufanilic acid, barium salt,4-anilinobenzenesulfonate; barium 2+ |
| IUPAC Name | 4-anilinobenzenesulfonate;barium(2+) |
| InChI Key | IVCNVXFNTKXMCA-UHFFFAOYSA-L |
| Molecular Formula | C24H20BaN2O6S2 |
4-Bromo-3-(trifluoromethyl)-1H-pyrazole, 97%, Thermo Scientific™
CAS: 19968-17-3 Molecular Formula: C4H2BrF3N2 Molecular Weight (g/mol): 214.97 InChI Key: JTHNMRUVJDWVMJ-UHFFFAOYSA-N Synonym: 4-bromo-3-trifluoromethyl-1h-pyrazole,4-bromo-5-trifluoromethyl-1h-pyrazole,1h-pyrazole, 4-bromo-3-trifluoromethyl,1h-pyrazole, 4-bromo-5-trifluoromethyl,1h-pyrazole,4-bromo-3-trifluoromethyl,4-bromo-3-trifluoromethyl pyrazole,4-bromo-3-trifluoromethyl-2h-pyrazole,acmc-209f4m,4-bromo-3 trifluoromethyl-1h-pyrazole PubChem CID: 7147398 IUPAC Name: 4-bromo-5-(trifluoromethyl)-1H-pyrazole SMILES: C1=NNC(=C1Br)C(F)(F)F
| PubChem CID | 7147398 |
|---|---|
| CAS | 19968-17-3 |
| Molecular Weight (g/mol) | 214.97 |
| SMILES | C1=NNC(=C1Br)C(F)(F)F |
| Synonym | 4-bromo-3-trifluoromethyl-1h-pyrazole,4-bromo-5-trifluoromethyl-1h-pyrazole,1h-pyrazole, 4-bromo-3-trifluoromethyl,1h-pyrazole, 4-bromo-5-trifluoromethyl,1h-pyrazole,4-bromo-3-trifluoromethyl,4-bromo-3-trifluoromethyl pyrazole,4-bromo-3-trifluoromethyl-2h-pyrazole,acmc-209f4m,4-bromo-3 trifluoromethyl-1h-pyrazole |
| IUPAC Name | 4-bromo-5-(trifluoromethyl)-1H-pyrazole |
| InChI Key | JTHNMRUVJDWVMJ-UHFFFAOYSA-N |
| Molecular Formula | C4H2BrF3N2 |
Sodium butyrate, 98+%
CAS: 156-54-7 Molecular Formula: C4H7NaO2 Molecular Weight (g/mol): 110.09 MDL Number: MFCD00002816 InChI Key: MFBOGIVSZKQAPD-UHFFFAOYSA-M Synonym: sodium butyrate,sodium butanoate,butyric acid sodium salt,butanoic acid, sodium salt,butyrate sodium,butyric acid, sodium salt,sodium n-butyrate,sodium propanecarboxylate,butyric acid, na,butanoic acid, sodium salt 1:1 PubChem CID: 5222465 ChEBI: CHEBI:64103 SMILES: [Na+].CCCC([O-])=O
| PubChem CID | 5222465 |
|---|---|
| CAS | 156-54-7 |
| Molecular Weight (g/mol) | 110.09 |
| ChEBI | CHEBI:64103 |
| MDL Number | MFCD00002816 |
| SMILES | [Na+].CCCC([O-])=O |
| Synonym | sodium butyrate,sodium butanoate,butyric acid sodium salt,butanoic acid, sodium salt,butyrate sodium,butyric acid, sodium salt,sodium n-butyrate,sodium propanecarboxylate,butyric acid, na,butanoic acid, sodium salt 1:1 |
| InChI Key | MFBOGIVSZKQAPD-UHFFFAOYSA-M |
| Molecular Formula | C4H7NaO2 |
1,2-Dimethylimidazole, 96+%
CAS: 1739-84-0 Molecular Formula: C5H8N2 Molecular Weight (g/mol): 96.13 MDL Number: MFCD00005294 InChI Key: GIWQSPITLQVMSG-UHFFFAOYSA-N Synonym: 1,2-dimethyl-1h-imidazole,1h-imidazole, 1,2-dimethyl,imidazole, 1,2-dimethyl,1h-imidazole, dimethyl,unii-q41bc3grjb,q41bc3grjb,lupragen r dmi,1,2-dimethylimdazole,1,2 dimethylimidazole,n,2-dimethylimidazole PubChem CID: 15617 IUPAC Name: 1,2-dimethylimidazole SMILES: CN1C=CN=C1C
| PubChem CID | 15617 |
|---|---|
| CAS | 1739-84-0 |
| Molecular Weight (g/mol) | 96.13 |
| MDL Number | MFCD00005294 |
| SMILES | CN1C=CN=C1C |
| Synonym | 1,2-dimethyl-1h-imidazole,1h-imidazole, 1,2-dimethyl,imidazole, 1,2-dimethyl,1h-imidazole, dimethyl,unii-q41bc3grjb,q41bc3grjb,lupragen r dmi,1,2-dimethylimdazole,1,2 dimethylimidazole,n,2-dimethylimidazole |
| IUPAC Name | 1,2-dimethylimidazole |
| InChI Key | GIWQSPITLQVMSG-UHFFFAOYSA-N |
| Molecular Formula | C5H8N2 |
N-(3-Bromopropyl)phthalimide, 98%
CAS: 5460-29-7 Molecular Formula: C11H10BrNO2 Molecular Weight (g/mol): 268.1 MDL Number: MFCD00005904 InChI Key: VKJCJJYNVIYVQR-UHFFFAOYSA-N Synonym: n-3-bromopropyl phthalimide,2-3-bromopropyl isoindoline-1,3-dione,1-phthalimido-3-bromopropane,3-bromopropylphthalimide,n-3-bromopropylphthalimide,gamma-bromopropylphthalimide,2-3-bromopropyl-1h-isoindole-1,3 2h-dione,2-3-bromopropyl-2,3-dihydro-1h-isoindole-1,3-dione,phthalimide, n-3-bromopropyl,1h-isoindole-1,3 2h-dione, 2-3-bromopropyl PubChem CID: 21611 IUPAC Name: 2-(3-bromopropyl)isoindole-1,3-dione SMILES: C1=CC=C2C(=C1)C(=O)N(C2=O)CCCBr
| PubChem CID | 21611 |
|---|---|
| CAS | 5460-29-7 |
| Molecular Weight (g/mol) | 268.1 |
| MDL Number | MFCD00005904 |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCBr |
| Synonym | n-3-bromopropyl phthalimide,2-3-bromopropyl isoindoline-1,3-dione,1-phthalimido-3-bromopropane,3-bromopropylphthalimide,n-3-bromopropylphthalimide,gamma-bromopropylphthalimide,2-3-bromopropyl-1h-isoindole-1,3 2h-dione,2-3-bromopropyl-2,3-dihydro-1h-isoindole-1,3-dione,phthalimide, n-3-bromopropyl,1h-isoindole-1,3 2h-dione, 2-3-bromopropyl |
| IUPAC Name | 2-(3-bromopropyl)isoindole-1,3-dione |
| InChI Key | VKJCJJYNVIYVQR-UHFFFAOYSA-N |
| Molecular Formula | C11H10BrNO2 |
Dimethyl maleate, 96%
CAS: 624-48-6 Molecular Formula: C6H8O4 Molecular Weight (g/mol): 144.13 MDL Number: MFCD00008459 InChI Key: LDCRTTXIJACKKU-ARJAWSKDSA-N Synonym: dimethyl maleate,maleic acid, dimethyl ester,methyl maleate,sipomer dmm,maleic acid dimethyl ester,dimethyl cis-butenedioate,2-butenedioic acid z-, dimethyl ester,dimethyl cis-ethylenedicarboxylate,2-butenedioic acid 2z-, dimethyl ester,2-butenedioic acid, dimethyl ester, z PubChem CID: 5271565 ChEBI: CHEBI:35460 IUPAC Name: dimethyl (Z)-but-2-enedioate SMILES: COC(=O)C=CC(=O)OC
| PubChem CID | 5271565 |
|---|---|
| CAS | 624-48-6 |
| Molecular Weight (g/mol) | 144.13 |
| ChEBI | CHEBI:35460 |
| MDL Number | MFCD00008459 |
| SMILES | COC(=O)C=CC(=O)OC |
| Synonym | dimethyl maleate,maleic acid, dimethyl ester,methyl maleate,sipomer dmm,maleic acid dimethyl ester,dimethyl cis-butenedioate,2-butenedioic acid z-, dimethyl ester,dimethyl cis-ethylenedicarboxylate,2-butenedioic acid 2z-, dimethyl ester,2-butenedioic acid, dimethyl ester, z |
| IUPAC Name | dimethyl (Z)-but-2-enedioate |
| InChI Key | LDCRTTXIJACKKU-ARJAWSKDSA-N |
| Molecular Formula | C6H8O4 |
Sodium succinate hexahydrate, 99%
CAS: 6106-21-4 Molecular Formula: C4H16Na2O10 Molecular Weight (g/mol): 270.142 MDL Number: MFCD00149117 InChI Key: ZBTUYCUNQBRXOR-UHFFFAOYSA-L Synonym: disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate PubChem CID: 3083938 ChEBI: CHEBI:63686 IUPAC Name: disodium;butanedioate;hexahydrate SMILES: C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+]
| PubChem CID | 3083938 |
|---|---|
| CAS | 6106-21-4 |
| Molecular Weight (g/mol) | 270.142 |
| ChEBI | CHEBI:63686 |
| MDL Number | MFCD00149117 |
| SMILES | C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+] |
| Synonym | disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate |
| IUPAC Name | disodium;butanedioate;hexahydrate |
| InChI Key | ZBTUYCUNQBRXOR-UHFFFAOYSA-L |
| Molecular Formula | C4H16Na2O10 |
(Methoxycarbonylsulfamoyl)triethylammonium hydroxide, 97%, inner salt
CAS: 29684-56-8 Molecular Formula: C8H18N2O4S Molecular Weight (g/mol): 238.30 MDL Number: MFCD00077815 InChI Key: YSHOWEKUVWPFNR-UHFFFAOYSA-N Synonym: methoxycarbonylsulfamoyl triethylammonium hydroxide,burgess reagent,carbomethoxysulfamoyltriethylammonium hydroxide,methoxycarbonylsulfamoyltriethylammonium hydroxide,methoxycarbonylsulphamoyltriethylammonium hydroxide,methoxy-carbonylsulfamoyltriethylammonium hydroxide,methoxycarbonylsulfa-moyl-triethylammonium hydroxide,methoxycarbonylsulphamoyl-triethylammonium hydroxide PubChem CID: 11032497 SMILES: CC[N+](CC)(CC)S(=O)(=O)[N-]C(=O)OC
| PubChem CID | 11032497 |
|---|---|
| CAS | 29684-56-8 |
| Molecular Weight (g/mol) | 238.30 |
| MDL Number | MFCD00077815 |
| SMILES | CC[N+](CC)(CC)S(=O)(=O)[N-]C(=O)OC |
| Synonym | methoxycarbonylsulfamoyl triethylammonium hydroxide,burgess reagent,carbomethoxysulfamoyltriethylammonium hydroxide,methoxycarbonylsulfamoyltriethylammonium hydroxide,methoxycarbonylsulphamoyltriethylammonium hydroxide,methoxy-carbonylsulfamoyltriethylammonium hydroxide,methoxycarbonylsulfa-moyl-triethylammonium hydroxide,methoxycarbonylsulphamoyl-triethylammonium hydroxide |
| InChI Key | YSHOWEKUVWPFNR-UHFFFAOYSA-N |
| Molecular Formula | C8H18N2O4S |
D-(-)-Fructose 99.0+%, TCI America™
CAS: 57-48-7 Molecular Formula: C6H12O6 Molecular Weight (g/mol): 180.156 MDL Number: MFCD00148910 InChI Key: BJHIKXHVCXFQLS-UYFOZJQFSA-N Synonym: d---fructose,d--fructose,3s,4r,5r-1,3,4,5,6-pentahydroxyhexan-2-one,furucton,arabino-hexulose,keto-d-fructose,d-levulose,sugar, fruit,fructose, d,krystar 300 PubChem CID: 5984 ChEBI: CHEBI:48095 IUPAC Name: (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one SMILES: C(C(C(C(C(=O)CO)O)O)O)O
| PubChem CID | 5984 |
|---|---|
| CAS | 57-48-7 |
| Molecular Weight (g/mol) | 180.156 |
| ChEBI | CHEBI:48095 |
| MDL Number | MFCD00148910 |
| SMILES | C(C(C(C(C(=O)CO)O)O)O)O |
| Synonym | d---fructose,d--fructose,3s,4r,5r-1,3,4,5,6-pentahydroxyhexan-2-one,furucton,arabino-hexulose,keto-d-fructose,d-levulose,sugar, fruit,fructose, d,krystar 300 |
| IUPAC Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| InChI Key | BJHIKXHVCXFQLS-UYFOZJQFSA-N |
| Molecular Formula | C6H12O6 |
Trifluoromethanesulfonic Anhydride 98.0+%, TCI America™
CAS: 358-23-6 Molecular Formula: C2F6O5S2 Molecular Weight (g/mol): 282.127 MDL Number: MFCD00000408 InChI Key: WJKHJLXJJJATHN-UHFFFAOYSA-N Synonym: trifluoromethanesulfonic anhydride,triflic anhydride,trifluoromethanesulphonic anhydride,trifluoromethanesulfonic acid anhydride,methanesulfonic acid, trifluoro-, anhydride,trifluoromethanesulphonic acid anhydride,unii-8w034lhg1u,tf2o,trifluoromethane sulfonyl trifluoromethanesulfonate,trifluoromethane sulfonic anhydride PubChem CID: 67749 ChEBI: CHEBI:48509 IUPAC Name: trifluoromethylsulfonyl trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F
| PubChem CID | 67749 |
|---|---|
| CAS | 358-23-6 |
| Molecular Weight (g/mol) | 282.127 |
| ChEBI | CHEBI:48509 |
| MDL Number | MFCD00000408 |
| SMILES | C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F |
| Synonym | trifluoromethanesulfonic anhydride,triflic anhydride,trifluoromethanesulphonic anhydride,trifluoromethanesulfonic acid anhydride,methanesulfonic acid, trifluoro-, anhydride,trifluoromethanesulphonic acid anhydride,unii-8w034lhg1u,tf2o,trifluoromethane sulfonyl trifluoromethanesulfonate,trifluoromethane sulfonic anhydride |
| IUPAC Name | trifluoromethylsulfonyl trifluoromethanesulfonate |
| InChI Key | WJKHJLXJJJATHN-UHFFFAOYSA-N |
| Molecular Formula | C2F6O5S2 |